Tel: 400-711-5280 Email: sales@molcore.com

Products Sitemap

Name Index N

SKU Chemical Name Molecular Formula
MC445825 1773489-72-7 | Nidufexor C27H22ClN3O4
MC445810 125545-98-4 | Methyl 1-Boc-4-oxopiperidine-2-carboxylate C12H19NO5
MC445800 223673-36-7 | (R)-tert-butyl 4-aminophenethyl(2-hydroxy-2-phenylethyl)carbamate C21H28N2O3
MC445783 335654-34-7 | N,N-dibutyl-5,6,12,13-tetrakis(4-(1,1-dimethylethyl)phenoxy)- 3,4,9,10-perylenedicarboximide C72H74N2O8
MC445773 82953-57-9 | N,N-Bis(2,6-diisopropylphenyl)-3,4,9,10-perylenetetracarboxylic Diimide C48H42N2O4
MC445762 36127-33-0 | N,N-bis(3-methyl-2-butenyl)aniline C16H23N
MC445758 1116039-25-8 | N4,N4'-bis[4-(5-phenyl-2-thienyl)phenyl]-[1,1'-biphenyl]- 4,4'-diamine C44H32N2S2
MC445757 1085434-28-1 | N-[5-phenyl-2-thienyl]phenyl]-1-naphthalenamine C26H19NS
MC445754 944151-83-1 | N-phenyl-[1,1':4',1'':4'',1'''-quaterphenyl]-4-amine C30H23N
MC445753 585570-08-7 | N,N-Bis(4-bromophenyl)benzidine C24H18Br2N2
MC445649 121-05-1 | N,N-Diisopropylethylenediamine C8H20N2
MC445648 157115-85-0 | Noopept C17H22N2O4
MC445646 23111-00-4 | Nicotinamide riboside chloride C11H15ClN2O5
MC445641 112193-35-8 | Nooglutyl C11H12N2O6
MC445640 1422144-42-0 | Netarsudil mesylate C30H35N3O9S2
MC445634 211685-96-0 | N-phenyl-3,6-di(N-carbazolyl)carbazole C42H27N3
MC445633 1002762-60-8 | N-biphenyl-4-yl-9-phenyl-9H-Carbazol-3-amine C30H22N2
MC445632 1372778-66-9 | N-([1,1'-biphenyl]3-yl)-9,9-dimethyl-9H-fluoren-2-amine C27H23N
MC445629 167218-39-5 | N,N-Bis(4'-diphenylamino-4-biphenylyl)amine C48H37N3
MC445628 952431-34-4 | N4,N4,N4'',N4''-Tetrakis([1,1'-biphenyl]-4-yl)-[1,1':4',1''-terphenyl]-4,4''-diamine C66H48N2
MC445627 145898-89-1 | N,N,N',N'-Tetraphenyl[1,1':4',1'':4'',1'''-quaterphenyl]-4,4'''-diamine C48H36N2
MC445623 100953-52-4 | N-(4-BroMo-phenyl)-benzene-1,2-diaMine C12H11BrN2
MC445620 110677-45-7 | 4-(9H-Carbazol-9-yl)benzaldehyde C19H13NO
MC445609 357645-40-0 | N,N'-Di(1-naphthyl)-N,N',9,9-tetraphenyl-9H-fluorene-2,7-diamine C57H40N2
MC445592 153437-78-6 | N-(3-chloro-4-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine C16H13ClFN3O2
MC445590 1502829-45-9 | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholinopropoxy)-N-(3-morpholinopropyl)quinazolin-4-amine C29H37ClFN5O4
MC445561 894783-71-2 | (Z)-3-(((4-(N-methyl-2-(4-methylpiperazin-1-yl)acetamido)phenyl)amino)(phenyl)methylene)-2-oxoindoline-6-carboxylic acid C30H31N5O4
MC445552 187389-53-3 | N-BOC-D-FMK C11H18FNO5
MC445521 91941-04-7 | N-(2-amino-6-((4-fluorobenzyl)amino)pyridin-3-yl)acetamide hydrochloride C14H16ClFN4O
MC445515 477600-73-0 | N-((3R,4R)-1-benzyl-4-methylpiperidin-3-yl)-N-methyl-7H- pyrrolo[2,3-d]pyrimidin-4-amine C20H25N5