Tel: 400-711-5280 Email: sales@molcore.com

Products Sitemap

Cas Index 1

SKU Chemical Name Molecular Formula
MC445638 1246308-80-4 | 4-(2-nitrophenyl)Dibenzofuran C18H11NO3
MC445633 1002762-60-8 | N-biphenyl-4-yl-9-phenyl-9H-Carbazol-3-amine C30H22N2
MC445632 1372778-66-9 | N-([1,1'-biphenyl]3-yl)-9,9-dimethyl-9H-fluoren-2-amine C27H23N
MC445630 1442458-61-8 | 5H-Benzo-a-1-benzothieno-3-2-c-carbazole C22H13NS
MC445629 167218-39-5 | N,N-Bis(4'-diphenylamino-4-biphenylyl)amine C48H37N3
MC445627 145898-89-1 | N,N,N',N'-Tetraphenyl[1,1':4',1'':4'',1'''-quaterphenyl]-4,4'''-diamine C48H36N2
MC445624 1146340-38-6 | 1-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-phenyl]-1H-benzimidazole C25H25BN2O2
MC445623 100953-52-4 | N-(4-BroMo-phenyl)-benzene-1,2-diaMine C12H11BrN2
MC445622 1243390-68-2 | 3-cyclopropoxy-2-methoxypyridine C9H11NO2
MC445620 110677-45-7 | 4-(9H-Carbazol-9-yl)benzaldehyde C19H13NO
MC445619 10273-90-2 | 3-methyl-2-phenylpyridine C12H11N
MC445614 1173886-71-9 | Bis(2-phenylquinoline)(acetylacetonate)iridium(III) C35H28IrN2O2
MC445612 1214-16-0 | 3,6-Dibromo-9-vinyl-9H-carbazole C14H9Br2N
MC445611 1438252-33-5 | 2,7-Dibromo-9-vinyl-9H-carbazole C14H9Br2N
MC445610 16372-96-6 | 3,5-DibroMo-biphenyl C12H8Br2
MC445608 17026-85-6 | Potassium cetyl phosphate C16H33K2O4P
MC445607 104116-17-8 | (2-Methoxynaphthalen-1-yl)boronic acid C11H11BO3
MC445605 1266134-54-6 | 2-Azido-1,3-dimethylimidazolinium Hexafluorophosphate C5H10F6N5P
MC445604 1231220-79-3 | 8-(2-Chlorophenyl)-2-methyl-6-(4-methylpiperazin-1-yl)-9-(tetrahydro-2H-pyran-4-yl)-9H-purine C22H27ClN6O
MC445601 128446-36-6 | Methyl-β-cyclodextrin C54H94O35
MC445596 18979-72-1 | 3-Butoxyphenol C10H14O2
MC445594 19130-92-8 | DL-erythro Ritalinic Acid Hydrochloride C13H18ClNO2
MC445592 153437-78-6 | N-(3-chloro-4-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine C16H13ClFN3O2
MC445590 1502829-45-9 | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholinopropoxy)-N-(3-morpholinopropyl)quinazolin-4-amine C29H37ClFN5O4
MC445588 1006378-06-8 | 4-methoxy-3-(3-morpholinopropoxy)-2-nitrobenzonitrile C15H19N3O5
MC445585 1150-62-5 | 9-Phenylcarbazole C18H13N
MC445583 1174006-43-9 | 2,9-Bis(naphthalen-2-yl)-4,7-diphenyl-1,10-phenanthroline C44H28N2
MC445581 1021490-58-3 | Ir(MPPZ)3
MC445578 1318171-90-2 | Ir(mphq)2(tmd)
MC445577 1239886-63-5 | Bis(2-phenylpyrimidine -C2,N) (acetylacetonate)iridium(III)