Tel: 400-711-5280 Email: sales@molcore.com

Products Sitemap

Cas Index 6

SKU Chemical Name Molecular Formula
MC443463 643094-08-0 | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-naphthoate C18H21BO4
MC443459 68716-50-7 | 2-(2,4-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane C12H15BCl2O2
MC443436 685109-10-8 | 7-bromo-5-nitro-1H-indazole C7H4BrN3O2
MC443429 676501-84-1 | 2-(5-bromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane C10H14BBrO2S
MC443408 6134-54-9 | 5-bromo-2,3-dihydro-1H-indene C9H9Br
MC443397 6652-01-3 | 3-ethoxy-2-methylpyridine C8H11NO
MC443389 66999-64-2 | 3-bromo-5-chloro-[1,2,4]triazolo[4,3-a]pyridine C6H3BrClN3
MC443382 63136-61-8 | 4-chloro-7-methylquinoline C10H8ClN
MC443361 63744-41-2 | 5-chloroimidazo[1,2-a]pyrazine C6H4ClN3
MC443317 62507-84-0 | 3-(4-carboxyphenoxy)benzoic acid C14H10O5
MC443292 61857-83-8 | 2,2-dimethyl-5-(thiophen-3-yl)-1,3-dioxane-4,6-dione C10H10O4S
MC443280 69038-76-2 | 4-bromo-N1-methylbenzene-1,2-diamine C7H9BrN2
MC443274 62077-27-4 | 2,3-dichloro-6-methylaniline C7H7Cl2N
MC443273 62077-26-3 | 3,6-dichloro-2-methylaniline C7H7Cl2N
MC443272 64067-99-8 | ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate C9H8ClN3O2
MC443266 62885-41-0 | 3-methoxypyridin-4-ol C6H7NO2
MC443261 621-51-2 | 3-ethoxybenzoic acid C9H10O3
MC443246 6324-89-6 | 2,2-dimethylbenzo[d][1,3]dioxol-5-amine C9H11NO2
MC443245 648423-85-2 | imidazo[1,2-a]pyridine-7-carboxylic acid C8H6N2O2
MC443233 6042-35-9 | 2-iodonicotinic acid C6H4INO2
MC443196 6406-73-1 | 4-((diethylamino)methyl)aniline C11H18N2
MC443180 6751-75-3 | 2-bromobenzene-1,3-diol C6H5BrO2
MC443163 62674-71-9 | 2-iodo-6-methylpyridine C6H6IN
MC443130 610798-31-7 | N-(3-ethynylphenyl)-7,8,10,11,13,14-hexahydro-[1,4,7,10]tetraoxacyclododecino[2,3-g]quinazolin-4-amine C22H21N3O4
MC443110 690206-97-4 | N-(4-chloro-2-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine C16H13ClFN3O2
MC443044 6506-37-2 | 4-(2-(5-nitro-1H-imidazol-1-yl)ethyl)morpholine C9H14N4O3
MC443043 6497-78-5 | 4-(2-(4-nitro-1H-imidazol-1-yl)ethyl)morpholine C9H14N4O3
MC442974 607737-87-1 | 4-(3-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl)quinoline C18H14N4
MC442962 61203-52-9 | 4-bromo-2,3-dihydroxybenzoic acid C7H5BrO4
MC442958 627526-31-2 | 2-(7-methoxynaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane C17H21BO3