Tel: 400-711-5280 Email:

Products Sitemap

Cas Index 6

SKU Chemical Name Molecular Formula
MC443280 69038-76-2 | 4-bromo-N1-methylbenzene-1,2-diamine C7H9BrN2
MC443274 62077-27-4 | 2,3-dichloro-6-methylaniline C7H7Cl2N
MC443273 62077-26-3 | 3,6-dichloro-2-methylaniline C7H7Cl2N
MC443272 64067-99-8 | ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate C9H8ClN3O2
MC443266 62885-41-0 | 3-methoxypyridin-4-ol C6H7NO2
MC443261 621-51-2 | 3-ethoxybenzoic acid C9H10O3
MC443246 6324-89-6 | 2,2-dimethylbenzo[d][1,3]dioxol-5-amine C9H11NO2
MC443245 648423-85-2 | imidazo[1,2-a]pyridine-7-carboxylic acid C8H6N2O2
MC443233 6042-35-9 | 2-iodonicotinic acid C6H4INO2
MC443196 6406-73-1 | 4-((diethylamino)methyl)aniline C11H18N2
MC443180 6751-75-3 | 2-bromobenzene-1,3-diol C6H5BrO2
MC443163 62674-71-9 | 2-iodo-6-methylpyridine C6H6IN
MC443130 610798-31-7 | N-(3-ethynylphenyl)-7,8,10,11,13,14-hexahydro-[1,4,7,10]tetraoxacyclododecino[2,3-g]quinazolin-4-amine C22H21N3O4
MC443110 690206-97-4 | N-(4-chloro-2-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine C16H13ClFN3O2
MC443044 6506-37-2 | 4-(2-(5-nitro-1H-imidazol-1-yl)ethyl)morpholine C9H14N4O3
MC443043 6497-78-5 | 4-(2-(4-nitro-1H-imidazol-1-yl)ethyl)morpholine C9H14N4O3
MC442974 607737-87-1 | 4-(3-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl)quinoline C18H14N4
MC442962 61203-52-9 | 4-bromo-2,3-dihydroxybenzoic acid C7H5BrO4
MC442958 627526-31-2 | 2-(7-methoxynaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane C17H21BO3
MC442937 690632-26-9 | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene-2-carboxylate C16H19BO4S
MC442868 677746-35-9 | 2-methoxy-5-nitrophenylboronic acid C7H8BNO5
MC442849 677777-45-6 | 4-cyano-3-methoxyphenylboronic acid C8H8BNO3
MC442833 63862-91-9 | 2-bromo-3,6-dichlorophenol C6H3BrCl2O
MC442807 6542-37-6 | (tetrahydro-1H-oxazolo[3,4-c]oxazol-7a-yl)methanol C6H11NO3
MC442760 6882-74-2 | 4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine C6H9N3
MC442752 63260-35-5 | N-(piperidin-4-yl)pyridin-3-amine C10H15N3
MC442746 66909-34-0 | 2-chloro-5-methylnicotinonitrile C7H5ClN2
MC442731 69088-96-6 | 4-(3-aminophenyl)-2-methylbut-3-yn-2-ol C11H13NO
MC442695 62559-08-4 | 4-tert-butyl-1-methyl-2-nitrobenzene C11H15NO2
MC442666 6342-64-9 | 1-(5-chloro-2-methoxyphenyl)ethanone C9H9ClO2