Tel: 400-711-5280 Email: sales@molcore.com

Products Sitemap

Name Index N

SKU Chemical Name Molecular Formula
MC445592 153437-78-6 | N-(3-chloro-4-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine C16H13ClFN3O2
MC445590 1502829-45-9 | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholinopropoxy)-N-(3-morpholinopropyl)quinazolin-4-amine C29H37ClFN5O4
MC445561 894783-71-2 | (Z)-3-(((4-(N-methyl-2-(4-methylpiperazin-1-yl)acetamido)phenyl)amino)(phenyl)methylene)-2-oxoindoline-6-carboxylic acid C30H31N5O4
MC445552 187389-53-3 | N-BOC-D-FMK C11H18FNO5
MC445521 91941-04-7 | N-(2-amino-6-((4-fluorobenzyl)amino)pyridin-3-yl)acetamide hydrochloride C14H16ClFN4O
MC445515 477600-73-0 | N-((3R,4R)-1-benzyl-4-methylpiperidin-3-yl)-N-methyl-7H- pyrrolo[2,3-d]pyrimidin-4-amine C20H25N5
MC445514 923036-30-0 | N-((3R,4R)-1-benzyl-4-methylpiperidin-3-yl)-N-methyl-7-tosyl- 7H-pyrrolo[2,3-d]pyrimidin-4-amine C27H31N5O2S
MC445513 2028267-73-2 | N-((3R,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl)-N-methyl- 7H-pyrrolo[2,3-d]pyrimidin-4-amine oxide C16H20N6O2
MC445482 1220910-89-3 | benzyl (3-fluoro-4-(6-(2-methyl-2H-tetrazol-5-yl)pyridin-3-yl) phenyl)carbamate C21H17FN6O2
MC445465 142356-34-1 | N-Boc-7-bromoheptan-1-amine C12H24BrNO2
MC445462 176644-21-6 | Eniporide C14H16N4O3S
MC445461 1086063-46-8 | N-(5-bromo-2-methoxypyridin-3-yl)-2,4-difluorobenzenesulfonamide C12H9BrF2N2O3S
MC445456 1093100-40-3 | B-Raf inhibitor 1 C26H19ClN8
MC445424 557782-81-7 | N-(4,5-dihydronaphtho[1,2-d]thiazol-2-yl)-2-(3,4-dimethoxyphenyl)acetamide C21H20N2O3S
MC445381 1202003-49-3 | (S)-N-ALPHA-FMOC-N-EPSILON-BOC-ALPHA-METHYLLYSINE C27H34N2O6
MC445380 1068435-19-7 | N-Fmoc-2-amino-2-(3-pentenyl)hex-5-enoic acid C26H29NO4
MC445360 158563-45-2 | Nonapeptide-1 C61H87N15O9S
MC445320 124584-08-3 | Nesiritide C143H244N50O42S4
MC445261 1508250-71-2 | Nazartinib C26H31ClN6O2
MC445232 1315355-93-1 | NG25 C29H30F3N5O2
MC445179 51803-78-2 | Nimesulide C13H12N2O5S
MC445172 1689-89-0 | Nitroxinil C7H3IN2O3
MC445159 7377-08-4 | N-(4-Aminobenzoyl)-beta-alanine C10H12N2O3
MC445126 4936-47-4 | Nifuratel C10H11N3O5S
MC445123 118-29-6 | N-(Hydroxymethyl)phthalimide C9H7NO3
MC445030 134030-21-0 | N,N'-Bis(2,4,6-trimethylphenyl)ethylenediamine C20H28N2
MC445029 134030-22-1 | N,N'-Bis(2,6-diisopropylphenyl)ethylenediamine C26H40N2
MC445008 29046-78-4 | Nickel(II) chloride ethylene glycol dimethyl ether complex C4H10Cl2NiO2
MC444886 4762-26-9 | n-Hexyl-triphenylphosphonium bromide C24H28BrP
MC444845 7650-84-2 | n-Propyldiphenylphosphine C15H17P